About 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone
2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone (PubChem CID 115386024) has the molecular formula C15H17NOS3
and a molecular weight of 323.51 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
| PubChem CID | 115386024 |
| Molecular Formula | C15H17NOS3 |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CCC1SCCSC1C(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H17NOS3/c1-2-12-15(19-8-7-18-12)11(17)9-14-16-10-5-3-4-6-13(10)20-14/h3-6,12,15H,2,7-9H2,1H3 |
| InChIKey | IFSYLFSTZXWRCW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone?
The IUPAC name of 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone (CID 115386024) is 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone.
What is the SMILES notation for 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone?
The canonical SMILES for 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone is CCC1SCCSC1C(=O)Cc1nc2ccccc2s1.
What is the InChIKey of 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone?
The InChIKey is IFSYLFSTZXWRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NOS3/c1-2-12-15(19-8-7-18-12)11(17)9-14-16-10-5-3-4-6-13(10)20-14/h3-6,12,15H,2,7-9H2,1H3.
What are the key properties of 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone?
2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone has a molecular weight of 323.51 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-yl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone is sourced from PubChem (CID 115386024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).