C14H17NO2S — CID 105118535
1-(1,3-benzothiazol-2-yl)-4-propoxybutan-2-one (PubChem CID 105118535) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4-propoxybutan-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4-propoxybutan-2-one |
|---|---|
| PubChem CID | 105118535 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4-propoxybutan-2-one |
| SMILES | CCCOCCC(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17NO2S/c1-2-8-17-9-7-11(16)10-14-15-12-5-3-4-6-13(12)18-14/h3-6H,2,7-10H2,1H3 |
| InChIKey | UUPXVEGWRLHHAQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|