C16H22N2OS — CID 116574888
7-amino-1-(1,3-benzothiazol-2-yl)-5,5-dimethylheptan-2-one (PubChem CID 116574888) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 7-amino-1-(1,3-benzothiazol-2-yl)-5,5-dimethylheptan-2-one.
| Compound Name | 7-amino-1-(1,3-benzothiazol-2-yl)-5,5-dimethylheptan-2-one |
|---|---|
| PubChem CID | 116574888 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 7-amino-1-(1,3-benzothiazol-2-yl)-5,5-dimethylheptan-2-one |
| SMILES | CC(C)(CCN)CCC(=O)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H22N2OS/c1-16(2,9-10-17)8-7-12(19)11-15-18-13-5-3-4-6-14(13)20-15/h3-6H,7-11,17H2,1-2H3 |
| InChIKey | QFZITGRHUVKTBV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |