C15H20N2OS — CID 63801612
3-(3-aminoprop-1-ynyl)-N-cycloheptylthiophene-2-carboxamide (PubChem CID 63801612) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-cycloheptylthiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-cycloheptylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 63801612 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-cycloheptylthiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C15H20N2OS/c16-10-5-6-12-9-11-19-14(12)15(18)17-13-7-3-1-2-4-8-13/h9,11,13H,1-4,7-8,10,16H2,(H,17,18) |
| InChIKey | MWWKLFMTZGIIOA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|