C10H10F2N2OS — CID 115408372
3-(3-aminoprop-1-ynyl)-N-(2,2-difluoroethyl)thiophene-2-carboxamide (PubChem CID 115408372) has the molecular formula C10H10F2N2OS and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(2,2-difluoroethyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(2,2-difluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 115408372 |
| Molecular Formula | C10H10F2N2OS |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(2,2-difluoroethyl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)NCC(F)F |
| InChI | InChI=1S/C10H10F2N2OS/c11-8(12)6-14-10(15)9-7(2-1-4-13)3-5-16-9/h3,5,8H,4,6,13H2,(H,14,15) |
| InChIKey | CNNCVJOFTIQDSL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|