C10H14N2O3S2 — CID 114811971
4-[2-[(methylsulfamoylamino)methyl]thiophen-3-yl]but-3-yn-1-ol (PubChem CID 114811971) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-[2-[(methylsulfamoylamino)methyl]thiophen-3-yl]but-3-yn-1-ol.
| Compound Name | 4-[2-[(methylsulfamoylamino)methyl]thiophen-3-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 114811971 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-[2-[(methylsulfamoylamino)methyl]thiophen-3-yl]but-3-yn-1-ol |
| SMILES | CNS(=O)(=O)NCc1sccc1C#CCCO |
| InChI | InChI=1S/C10H14N2O3S2/c1-11-17(14,15)12-8-10-9(5-7-16-10)4-2-3-6-13/h5,7,11-13H,3,6,8H2,1H3 |
| InChIKey | BZKYHWHYKWEANO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|