C15H23NO2S — CID 107203692
5-[[3-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl-methylamino]pentan-1-ol (PubChem CID 107203692) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-[[3-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl-methylamino]pentan-1-ol.
| Compound Name | 5-[[3-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107203692 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[[3-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)Cc1sccc1C#CCCO |
| InChI | InChI=1S/C15H23NO2S/c1-16(9-4-2-5-10-17)13-15-14(8-12-19-15)7-3-6-11-18/h8,12,17-18H,2,4-6,9-11,13H2,1H3 |
| InChIKey | OOISFJGYUNUGPT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|