C16H23FN2O — CID 107203671
5-[[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]methyl-methylamino]pentan-1-ol (PubChem CID 107203671) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 5-[[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]methyl-methylamino]pentan-1-ol.
| Compound Name | 5-[[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]methyl-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107203671 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 5-[[3-(3-aminoprop-1-ynyl)-4-fluorophenyl]methyl-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)Cc1ccc(F)c(C#CCN)c1 |
| InChI | InChI=1S/C16H23FN2O/c1-19(10-3-2-4-11-20)13-14-7-8-16(17)15(12-14)6-5-9-18/h7-8,12,20H,2-4,9-11,13,18H2,1H3 |
| InChIKey | YYQSCILOCBAKPP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|