C12H14Cl2N2O4 — CID 69010613
ethyl 3-[(3,5-dichloro-4-hydroxyphenyl)carbamoylamino]propanoate (PubChem CID 69010613) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is ethyl 3-[(3,5-dichloro-4-hydroxyphenyl)carbamoylamino]propanoate.
| Compound Name | ethyl 3-[(3,5-dichloro-4-hydroxyphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 69010613 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | ethyl 3-[(3,5-dichloro-4-hydroxyphenyl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O4/c1-2-20-10(17)3-4-15-12(19)16-7-5-8(13)11(18)9(14)6-7/h5-6,18H,2-4H2,1H3,(H2,15,16,19) |
| InChIKey | LXAAQFIGEZMTKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|