C13H18N2O4 — CID 10468107
ethyl 3-[(2-hydroxy-4-methylphenyl)carbamoylamino]propanoate (PubChem CID 10468107) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 3-[(2-hydroxy-4-methylphenyl)carbamoylamino]propanoate.
| Compound Name | ethyl 3-[(2-hydroxy-4-methylphenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 10468107 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | ethyl 3-[(2-hydroxy-4-methylphenyl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)Nc1ccc(C)cc1O |
| InChI | InChI=1S/C13H18N2O4/c1-3-19-12(17)6-7-14-13(18)15-10-5-4-9(2)8-11(10)16/h4-5,8,16H,3,6-7H2,1-2H3,(H2,14,15,18) |
| InChIKey | FOVRBHZLPBNNTM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|