C19H24N2O3 — CID 108881813
1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-hydroxy-4-methylphenyl)urea (PubChem CID 108881813) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-hydroxy-4-methylphenyl)urea.
| Compound Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-hydroxy-4-methylphenyl)urea |
|---|---|
| PubChem CID | 108881813 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-hydroxy-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCCOc2c(C)cccc2C)c(O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-13-8-9-16(17(22)12-13)21-19(23)20-10-5-11-24-18-14(2)6-4-7-15(18)3/h4,6-9,12,22H,5,10-11H2,1-3H3,(H2,20,21,23) |
| InChIKey | ONXHUCANDDTDFP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|