C18H21ClN2O2 — CID 112973357
1-(4-chloro-2-methylphenyl)-3-[2-(2,6-dimethylphenoxy)ethyl]urea (PubChem CID 112973357) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-[2-(2,6-dimethylphenoxy)ethyl]urea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-[2-(2,6-dimethylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112973357 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-[2-(2,6-dimethylphenoxy)ethyl]urea |
| SMILES | Cc1cc(Cl)ccc1NC(=O)NCCOc1c(C)cccc1C |
| InChI | InChI=1S/C18H21ClN2O2/c1-12-5-4-6-13(2)17(12)23-10-9-20-18(22)21-16-8-7-15(19)11-14(16)3/h4-8,11H,9-10H2,1-3H3,(H2,20,21,22) |
| InChIKey | MZOHKMILGKINCA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|