C21H28N2O2 — CID 108881561
1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-propan-2-ylphenyl)urea (PubChem CID 108881561) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 108881561 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-[3-(2,6-dimethylphenoxy)propyl]-3-(2-propan-2-ylphenyl)urea |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C21H28N2O2/c1-15(2)18-11-5-6-12-19(18)23-21(24)22-13-8-14-25-20-16(3)9-7-10-17(20)4/h5-7,9-12,15H,8,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | YHCVNDORIBKVGC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|