C8H10ClN3O3S — CID 62234708
6-chloro-N-(2-sulfamoylethyl)pyridine-2-carboxamide (PubChem CID 62234708) has the molecular formula C8H10ClN3O3S and a molecular weight of 263.71 g/mol. Its IUPAC name is 6-chloro-N-(2-sulfamoylethyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(2-sulfamoylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62234708 |
| Molecular Formula | C8H10ClN3O3S |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 6-chloro-N-(2-sulfamoylethyl)pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O3S/c9-7-3-1-2-6(12-7)8(13)11-4-5-16(10,14)15/h1-3H,4-5H2,(H,11,13)(H2,10,14,15) |
| InChIKey | GLDQGOYMXFDHAJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|