C15H13ClKNO2 — CID 163956747
potassium 2-[2-(3-chloro-2-methylanilino)phenyl]acetate (PubChem CID 163956747) has the molecular formula C15H13ClKNO2 and a molecular weight of 313.83 g/mol. Its IUPAC name is potassium 2-[2-(3-chloro-2-methylanilino)phenyl]acetate.
| Compound Name | potassium 2-[2-(3-chloro-2-methylanilino)phenyl]acetate |
|---|---|
| PubChem CID | 163956747 |
| Molecular Formula | C15H13ClKNO2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | potassium 2-[2-(3-chloro-2-methylanilino)phenyl]acetate |
| SMILES | Cc1c(Cl)cccc1Nc1ccccc1CC(=O)[O-].[K+] |
| InChI | InChI=1S/C15H14ClNO2.K/c1-10-12(16)6-4-8-13(10)17-14-7-3-2-5-11(14)9-15(18)19;/h2-8,17H,9H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | SEAJGEJITBMQGI-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |