C22H26AlCl2N3O3 — CID 174078245
CID 174078245 (PubChem CID 174078245) has the molecular formula C22H26AlCl2N3O3 and a molecular weight of 478.36 g/mol.
| Compound Name | CID 174078245 |
|---|---|
| PubChem CID | 174078245 |
| Molecular Formula | C22H26AlCl2N3O3 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | — |
| SMILES | O=C(CN[Al])NCCCCCCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H26Cl2N3O3.Al/c23-17-9-7-10-18(24)22(17)27-19-11-4-3-8-16(19)14-21(29)30-13-6-2-1-5-12-26-20(28)15-25;/h3-4,7-11,25,27H,1-2,5-6,12-15H2,(H,26,28);/q-1;+1 |
| InChIKey | AAFQRGNTLJMFJU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|