C23H28Cl2N2O2 — CID 142844653
3-(4-methylpiperidin-1-yl)propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 142844653) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 3-(4-methylpiperidin-1-yl)propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 142844653 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CC1CCN(CCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-17-10-13-27(14-11-17)12-5-15-29-22(28)16-18-6-2-3-9-21(18)26-23-19(24)7-4-8-20(23)25/h2-4,6-9,17,26H,5,10-16H2,1H3 |
| InChIKey | CCHDIJBXTRFOOV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|