C21H22Cl2N2O5 — CID 170335307
[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxymethyl 2-methylmorpholine-4-carboxylate (PubChem CID 170335307) has the molecular formula C21H22Cl2N2O5 and a molecular weight of 453.32 g/mol. Its IUPAC name is [2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxymethyl 2-methylmorpholine-4-carboxylate.
| Compound Name | [2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxymethyl 2-methylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 170335307 |
| Molecular Formula | C21H22Cl2N2O5 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | [2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxymethyl 2-methylmorpholine-4-carboxylate |
| SMILES | CC1CN(C(=O)OCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)CCO1 |
| InChI | InChI=1S/C21H22Cl2N2O5/c1-14-12-25(9-10-28-14)21(27)30-13-29-19(26)11-15-5-2-3-8-18(15)24-20-16(22)6-4-7-17(20)23/h2-8,14,24H,9-13H2,1H3 |
| InChIKey | CQLSJDWCRKVEDC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|