C33H38BrCl2N3O4 — CID 54552453
4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[[cyclohexyl(methyl)amino]methyl]benzoate (PubChem CID 54552453) has the molecular formula C33H38BrCl2N3O4 and a molecular weight of 691.49 g/mol. Its IUPAC name is 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[[cyclohexyl(methyl)amino]methyl]benzoate.
| Compound Name | 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[[cyclohexyl(methyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 54552453 |
| Molecular Formula | C33H38BrCl2N3O4 |
| Molecular Weight | 691.49 g/mol |
| Exact Mass | 689.14 |
| IUPAC Name | 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[[cyclohexyl(methyl)amino]methyl]benzoate |
| SMILES | CN(Cc1cc(C(=O)OCCCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C33H38BrCl2N3O4/c1-39(25-11-3-2-4-12-25)21-24-18-23(19-26(34)31(24)37)33(41)43-17-8-7-16-42-30(40)20-22-10-5-6-15-29(22)38-32-27(35)13-9-14-28(32)36/h5-6,9-10,13-15,18-19,25,38H,2-4,7-8,11-12,16-17,20-21,37H2,1H3 |
| InChIKey | ZKVPGRUVBWIAFV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.49 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|