C34H40BrCl2N3O4 — CID 70532986
5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate (PubChem CID 70532986) has the molecular formula C34H40BrCl2N3O4 and a molecular weight of 705.52 g/mol. Its IUPAC name is 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate.
| Compound Name | 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 70532986 |
| Molecular Formula | C34H40BrCl2N3O4 |
| Molecular Weight | 705.52 g/mol |
| Exact Mass | 703.16 |
| IUPAC Name | 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCCCCCOC(=O)Cc3ccccc3Nc3c(Cl)cccc3Cl)cc(Br)c2N)CCCC1 |
| InChI | InChI=1S/C34H40BrCl2N3O4/c1-2-34(15-6-7-16-34)39-22-25-19-24(20-26(35)31(25)38)33(42)44-18-9-3-8-17-43-30(41)21-23-11-4-5-14-29(23)40-32-27(36)12-10-13-28(32)37/h4-5,10-14,19-20,39-40H,2-3,6-9,15-18,21-22,38H2,1H3 |
| InChIKey | GMVJQHHYJLZDQA-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.52 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|