C30H36BrCl2N3O4 — CID 70548396
5-acetyloxypentyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 70548396) has the molecular formula C30H36BrCl2N3O4 and a molecular weight of 653.45 g/mol. Its IUPAC name is 5-acetyloxypentyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 5-acetyloxypentyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 70548396 |
| Molecular Formula | C30H36BrCl2N3O4 |
| Molecular Weight | 653.45 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | 5-acetyloxypentyl 4-amino-3-bromo-5-[(propan-2-ylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CC(=O)OCCCCCOC(=O)c1cc(Br)c(N)c(CNC(C)C)c1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C18H27BrN2O4.C12H9Cl2N/c1-12(2)21-11-15-9-14(10-16(19)17(15)20)18(23)25-8-6-4-5-7-24-13(3)22;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h9-10,12,21H,4-8,11,20H2,1-3H3;1-8,15H |
| InChIKey | AEHRKOWIIIHUCK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.45 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|