C39H52BrCl2N5O4 — CID 20516489
3-[4-(2-acetyloxyethyl)piperazin-1-yl]propyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 20516489) has the molecular formula C39H52BrCl2N5O4 and a molecular weight of 805.69 g/mol. Its IUPAC name is 3-[4-(2-acetyloxyethyl)piperazin-1-yl]propyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 3-[4-(2-acetyloxyethyl)piperazin-1-yl]propyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 20516489 |
| Molecular Formula | C39H52BrCl2N5O4 |
| Molecular Weight | 805.69 g/mol |
| Exact Mass | 803.26 |
| IUPAC Name | 3-[4-(2-acetyloxyethyl)piperazin-1-yl]propyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CCN(Cc1cc(C(=O)OCCCN2CCN(CCOC(C)=O)CC2)cc(Br)c1N)C1CCCCC1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C27H43BrN4O4.C12H9Cl2N/c1-3-32(24-8-5-4-6-9-24)20-23-18-22(19-25(28)26(23)29)27(34)36-16-7-10-30-11-13-31(14-12-30)15-17-35-21(2)33;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h18-19,24H,3-17,20,29H2,1-2H3;1-8,15H |
| InChIKey | WIEDNQHVFNPQLW-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|