C23H37BrClN3O2 — CID 20516177
2-[2-chloroethyl(propyl)amino]ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate (PubChem CID 20516177) has the molecular formula C23H37BrClN3O2 and a molecular weight of 502.93 g/mol. Its IUPAC name is 2-[2-chloroethyl(propyl)amino]ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate.
| Compound Name | 2-[2-chloroethyl(propyl)amino]ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 20516177 |
| Molecular Formula | C23H37BrClN3O2 |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-[2-chloroethyl(propyl)amino]ethyl 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
| SMILES | CCCN(CCCl)CCOC(=O)c1cc(Br)c(N)c(CN(CC)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H37BrClN3O2/c1-3-11-27(12-10-25)13-14-30-23(29)18-15-19(22(26)21(24)16-18)17-28(4-2)20-8-6-5-7-9-20/h15-16,20H,3-14,17,26H2,1-2H3 |
| InChIKey | XBZDTAHXXQPGFU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|