C20H31BrClN3O — CID 54551406
4-amino-3-bromo-N-(4-chlorobutyl)-5-[[cyclohexyl(ethyl)amino]methyl]benzamide (PubChem CID 54551406) has the molecular formula C20H31BrClN3O and a molecular weight of 444.85 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(4-chlorobutyl)-5-[[cyclohexyl(ethyl)amino]methyl]benzamide.
| Compound Name | 4-amino-3-bromo-N-(4-chlorobutyl)-5-[[cyclohexyl(ethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 54551406 |
| Molecular Formula | C20H31BrClN3O |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-amino-3-bromo-N-(4-chlorobutyl)-5-[[cyclohexyl(ethyl)amino]methyl]benzamide |
| SMILES | CCN(Cc1cc(C(=O)NCCCCCl)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C20H31BrClN3O/c1-2-25(17-8-4-3-5-9-17)14-16-12-15(13-18(21)19(16)23)20(26)24-11-7-6-10-22/h12-13,17H,2-11,14,23H2,1H3,(H,24,26) |
| InChIKey | ZKDQKHAUFKEKMM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|