C36H44BrCl2N3O8 — CID 70549084
(3S,4S,5S,6S)-1-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]phenyl]-9-[2-(2,6-dichloroanilino)phenyl]-2,3,4,5,6,7-hexahydroxynonane-1,8-dione (PubChem CID 70549084) has the molecular formula C36H44BrCl2N3O8 and a molecular weight of 797.57 g/mol. Its IUPAC name is (3S,4S,5S,6S)-1-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]phenyl]-9-[2-(2,6-dichloroanilino)phenyl]-2,3,4,5,6,7-hexahydroxynonane-1,8-dione.
| Compound Name | (3S,4S,5S,6S)-1-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]phenyl]-9-[2-(2,6-dichloroanilino)phenyl]-2,3,4,5,6,7-hexahydroxynonane-1,8-dione |
|---|---|
| PubChem CID | 70549084 |
| Molecular Formula | C36H44BrCl2N3O8 |
| Molecular Weight | 797.57 g/mol |
| Exact Mass | 795.17 |
| IUPAC Name | (3S,4S,5S,6S)-1-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]phenyl]-9-[2-(2,6-dichloroanilino)phenyl]-2,3,4,5,6,7-hexahydroxynonane-1,8-dione |
| SMILES | CCN(Cc1cc(C(=O)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)C(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C36H44BrCl2N3O8/c1-2-42(22-10-4-3-5-11-22)18-21-15-20(16-23(37)28(21)40)30(44)32(46)34(48)36(50)35(49)33(47)31(45)27(43)17-19-9-6-7-14-26(19)41-29-24(38)12-8-13-25(29)39/h6-9,12-16,22,31-36,41,45-50H,2-5,10-11,17-18,40H2,1H3/t31?,32?,33-,34-,35-,36-/m1/s1 |
| InChIKey | OMOBMUAIGSGDCA-MRFXAFHJSA-N |
| XLogP | 4.40 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|