C34H41BrCl2N4O3 — CID 70541586
4-[[4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoyl]amino]butyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 70541586) has the molecular formula C34H41BrCl2N4O3 and a molecular weight of 704.54 g/mol. Its IUPAC name is 4-[[4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoyl]amino]butyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 4-[[4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoyl]amino]butyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 70541586 |
| Molecular Formula | C34H41BrCl2N4O3 |
| Molecular Weight | 704.54 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | 4-[[4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoyl]amino]butyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CCNC(c1cc(C(=O)NCCCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C34H41BrCl2N4O3/c1-2-39-32(22-11-4-3-5-12-22)25-19-24(20-26(35)31(25)38)34(43)40-17-8-9-18-44-30(42)21-23-13-6-7-16-29(23)41-33-27(36)14-10-15-28(33)37/h6-7,10,13-16,19-20,22,32,39,41H,2-5,8-9,11-12,17-18,21,38H2,1H3,(H,40,43) |
| InChIKey | ZIMRQGVFWONXDG-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.54 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|