About 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate
9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate (PubChem CID 70534716) has the molecular formula C25H41BrN2O3
and a molecular weight of 497.52 g/mol. Its IUPAC name is 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate.
Molecular Properties
| Compound Name | 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate |
| PubChem CID | 70534716 |
| Molecular Formula | C25H41BrN2O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate |
| SMILES | CCNC(c1cc(C(=O)OCCCCCCCCCO)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C25H41BrN2O3/c1-2-28-24(19-13-9-8-10-14-19)21-17-20(18-22(26)23(21)27)25(30)31-16-12-7-5-3-4-6-11-15-29/h17-19,24,28-29H,2-16,27H2,1H3 |
| InChIKey | KWPRWIAXBZPOGE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate?
The IUPAC name of 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate (CID 70534716) is 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate.
What is the SMILES notation for 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate?
The canonical SMILES for 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate is CCNC(c1cc(C(=O)OCCCCCCCCCO)cc(Br)c1N)C1CCCCC1.
What is the InChIKey of 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate?
The InChIKey is KWPRWIAXBZPOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41BrN2O3/c1-2-28-24(19-13-9-8-10-14-19)21-17-20(18-22(26)23(21)27)25(30)31-16-12-7-5-3-4-6-11-15-29/h17-19,24,28-29H,2-16,27H2,1H3.
What are the key properties of 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate?
9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate has a molecular weight of 497.52 g/mol, XLogP of 6.14, 14 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxynonyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate is sourced from PubChem (CID 70534716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).