C22H36BrN3O2 — CID 57082029
4-amino-3-bromo-5-[1-(cyclohexylamino)propyl]-N-(6-hydroxyhexyl)benzamide (PubChem CID 57082029) has the molecular formula C22H36BrN3O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-amino-3-bromo-5-[1-(cyclohexylamino)propyl]-N-(6-hydroxyhexyl)benzamide.
| Compound Name | 4-amino-3-bromo-5-[1-(cyclohexylamino)propyl]-N-(6-hydroxyhexyl)benzamide |
|---|---|
| PubChem CID | 57082029 |
| Molecular Formula | C22H36BrN3O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-amino-3-bromo-5-[1-(cyclohexylamino)propyl]-N-(6-hydroxyhexyl)benzamide |
| SMILES | CCC(NC1CCCCC1)c1cc(C(=O)NCCCCCCO)cc(Br)c1N |
| InChI | InChI=1S/C22H36BrN3O2/c1-2-20(26-17-10-6-5-7-11-17)18-14-16(15-19(23)21(18)24)22(28)25-12-8-3-4-9-13-27/h14-15,17,20,26-27H,2-13,24H2,1H3,(H,25,28) |
| InChIKey | OFAVGAQJZPAHIE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|