C21H33BrClN3O — CID 70548817
4-amino-3-bromo-N-(5-chloropentyl)-5-[1-(cyclohexylamino)propyl]benzamide (PubChem CID 70548817) has the molecular formula C21H33BrClN3O and a molecular weight of 458.87 g/mol. Its IUPAC name is 4-amino-3-bromo-N-(5-chloropentyl)-5-[1-(cyclohexylamino)propyl]benzamide.
| Compound Name | 4-amino-3-bromo-N-(5-chloropentyl)-5-[1-(cyclohexylamino)propyl]benzamide |
|---|---|
| PubChem CID | 70548817 |
| Molecular Formula | C21H33BrClN3O |
| Molecular Weight | 458.87 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-amino-3-bromo-N-(5-chloropentyl)-5-[1-(cyclohexylamino)propyl]benzamide |
| SMILES | CCC(NC1CCCCC1)c1cc(C(=O)NCCCCCCl)cc(Br)c1N |
| InChI | InChI=1S/C21H33BrClN3O/c1-2-19(26-16-9-5-3-6-10-16)17-13-15(14-18(22)20(17)24)21(27)25-12-8-4-7-11-23/h13-14,16,19,26H,2-12,24H2,1H3,(H,25,27) |
| InChIKey | UHDCGUGHQUCWHO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|