C22H34BrN3O3 — CID 70568026
4-[[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]amino]butyl acetate (PubChem CID 70568026) has the molecular formula C22H34BrN3O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is 4-[[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]amino]butyl acetate.
| Compound Name | 4-[[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]amino]butyl acetate |
|---|---|
| PubChem CID | 70568026 |
| Molecular Formula | C22H34BrN3O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-[[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]amino]butyl acetate |
| SMILES | CCN(Cc1cc(C(=O)NCCCCOC(C)=O)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C22H34BrN3O3/c1-3-26(19-9-5-4-6-10-19)15-18-13-17(14-20(23)21(18)24)22(28)25-11-7-8-12-29-16(2)27/h13-14,19H,3-12,15,24H2,1-2H3,(H,25,28) |
| InChIKey | CKZXRCBUVHYRGF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|