C31H36BrCl2N3O4 — CID 20516493
2-acetyloxyethyl 4-amino-3-bromo-5-[[cyclopentyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 20516493) has the molecular formula C31H36BrCl2N3O4 and a molecular weight of 665.46 g/mol. Its IUPAC name is 2-acetyloxyethyl 4-amino-3-bromo-5-[[cyclopentyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 2-acetyloxyethyl 4-amino-3-bromo-5-[[cyclopentyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 20516493 |
| Molecular Formula | C31H36BrCl2N3O4 |
| Molecular Weight | 665.46 g/mol |
| Exact Mass | 663.13 |
| IUPAC Name | 2-acetyloxyethyl 4-amino-3-bromo-5-[[cyclopentyl(ethyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CCN(Cc1cc(C(=O)OCCOC(C)=O)cc(Br)c1N)C1CCCC1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C19H27BrN2O4.C12H9Cl2N/c1-3-22(16-6-4-5-7-16)12-15-10-14(11-17(20)18(15)21)19(24)26-9-8-25-13(2)23;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h10-11,16H,3-9,12,21H2,1-2H3;1-8,15H |
| InChIKey | BPRWDAWFHXHJCE-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.46 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|