C28H32BrCl2N3O4 — CID 70550166
4-acetyloxybutyl 4-amino-3-bromo-5-[(dimethylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 70550166) has the molecular formula C28H32BrCl2N3O4 and a molecular weight of 625.39 g/mol. Its IUPAC name is 4-acetyloxybutyl 4-amino-3-bromo-5-[(dimethylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 4-acetyloxybutyl 4-amino-3-bromo-5-[(dimethylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 70550166 |
| Molecular Formula | C28H32BrCl2N3O4 |
| Molecular Weight | 625.39 g/mol |
| Exact Mass | 623.10 |
| IUPAC Name | 4-acetyloxybutyl 4-amino-3-bromo-5-[(dimethylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CC(=O)OCCCCOC(=O)c1cc(Br)c(N)c(CN(C)C)c1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C16H23BrN2O4.C12H9Cl2N/c1-11(20)22-6-4-5-7-23-16(21)12-8-13(10-19(2)3)15(18)14(17)9-12;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h8-9H,4-7,10,18H2,1-3H3;1-8,15H |
| InChIKey | DKXLDOFWYFVVAK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.39 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|