C35H42BrCl2N3O4 — CID 20516504
4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[(1-cyclohexylpropylamino)methyl]benzoate (PubChem CID 20516504) has the molecular formula C35H42BrCl2N3O4 and a molecular weight of 719.55 g/mol. Its IUPAC name is 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[(1-cyclohexylpropylamino)methyl]benzoate.
| Compound Name | 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[(1-cyclohexylpropylamino)methyl]benzoate |
|---|---|
| PubChem CID | 20516504 |
| Molecular Formula | C35H42BrCl2N3O4 |
| Molecular Weight | 719.55 g/mol |
| Exact Mass | 717.17 |
| IUPAC Name | 4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxybutyl 4-amino-3-bromo-5-[(1-cyclohexylpropylamino)methyl]benzoate |
| SMILES | CCC(NCc1cc(C(=O)OCCCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C35H42BrCl2N3O4/c1-2-30(23-11-4-3-5-12-23)40-22-26-19-25(20-27(36)33(26)39)35(43)45-18-9-8-17-44-32(42)21-24-13-6-7-16-31(24)41-34-28(37)14-10-15-29(34)38/h6-7,10,13-16,19-20,23,30,40-41H,2-5,8-9,11-12,17-18,21-22,39H2,1H3 |
| InChIKey | FJFZBJMZWCSYDQ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.55 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|