C36H44BrCl2N3O4 — CID 20516125
6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyhexyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate (PubChem CID 20516125) has the molecular formula C36H44BrCl2N3O4 and a molecular weight of 733.58 g/mol. Its IUPAC name is 6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyhexyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate.
| Compound Name | 6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyhexyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 20516125 |
| Molecular Formula | C36H44BrCl2N3O4 |
| Molecular Weight | 733.58 g/mol |
| Exact Mass | 731.19 |
| IUPAC Name | 6-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyhexyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCCCCCCOC(=O)Cc3ccccc3Nc3c(Cl)cccc3Cl)cc(Br)c2N)CCCCC1 |
| InChI | InChI=1S/C36H44BrCl2N3O4/c1-2-36(17-8-5-9-18-36)41-24-27-21-26(22-28(37)33(27)40)35(44)46-20-11-4-3-10-19-45-32(43)23-25-13-6-7-16-31(25)42-34-29(38)14-12-15-30(34)39/h6-7,12-16,21-22,41-42H,2-5,8-11,17-20,23-24,40H2,1H3 |
| InChIKey | RCVTZZYBWJQHBR-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.58 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|