C20H31BrN2O3 — CID 20516148
5-hydroxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate (PubChem CID 20516148) has the molecular formula C20H31BrN2O3 and a molecular weight of 427.38 g/mol. Its IUPAC name is 5-hydroxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate.
| Compound Name | 5-hydroxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 20516148 |
| Molecular Formula | C20H31BrN2O3 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5-hydroxypentyl 4-amino-3-bromo-5-[[(1-ethylcyclopentyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCCCCCO)cc(Br)c2N)CCCC1 |
| InChI | InChI=1S/C20H31BrN2O3/c1-2-20(8-4-5-9-20)23-14-16-12-15(13-17(21)18(16)22)19(25)26-11-7-3-6-10-24/h12-13,23-24H,2-11,14,22H2,1H3 |
| InChIKey | CWGVZDQDQVAOSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|