C24H31BrN2O3 — CID 70531395
[4-(hydroxymethyl)phenyl]methyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate (PubChem CID 70531395) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]methyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate.
| Compound Name | [4-(hydroxymethyl)phenyl]methyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 70531395 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]methyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCc3ccc(CO)cc3)cc(Br)c2N)CCCCC1 |
| InChI | InChI=1S/C24H31BrN2O3/c1-2-24(10-4-3-5-11-24)27-14-20-12-19(13-21(25)22(20)26)23(29)30-16-18-8-6-17(15-28)7-9-18/h6-9,12-13,27-28H,2-5,10-11,14-16,26H2,1H3 |
| InChIKey | HIHWZURMITVDPS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|