C19H28BrClN2O2 — CID 20515993
5-chloropentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate (PubChem CID 20515993) has the molecular formula C19H28BrClN2O2 and a molecular weight of 431.80 g/mol. Its IUPAC name is 5-chloropentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate.
| Compound Name | 5-chloropentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate |
|---|---|
| PubChem CID | 20515993 |
| Molecular Formula | C19H28BrClN2O2 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 5-chloropentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate |
| SMILES | Nc1c(Br)cc(C(=O)OCCCCCCl)cc1CNC1CCCCC1 |
| InChI | InChI=1S/C19H28BrClN2O2/c20-17-12-14(19(24)25-10-6-2-5-9-21)11-15(18(17)22)13-23-16-7-3-1-4-8-16/h11-12,16,23H,1-10,13,22H2 |
| InChIKey | MSXLKOHGEVBJJD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|