C25H40BrClN2O2 — CID 20516233
9-chlorononyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate (PubChem CID 20516233) has the molecular formula C25H40BrClN2O2 and a molecular weight of 515.96 g/mol. Its IUPAC name is 9-chlorononyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate.
| Compound Name | 9-chlorononyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 20516233 |
| Molecular Formula | C25H40BrClN2O2 |
| Molecular Weight | 515.96 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 9-chlorononyl 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCCCCCCCCCCl)cc(Br)c2N)CCCCC1 |
| InChI | InChI=1S/C25H40BrClN2O2/c1-2-25(13-9-8-10-14-25)29-19-21-17-20(18-22(26)23(21)28)24(30)31-16-12-7-5-3-4-6-11-15-27/h17-18,29H,2-16,19,28H2,1H3 |
| InChIKey | YKOKLCIEAUZIMF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.96 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|