C38H40BrCl2N3O4 — CID 70530823
[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-phenylethyl] 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate (PubChem CID 70530823) has the molecular formula C38H40BrCl2N3O4 and a molecular weight of 753.57 g/mol. Its IUPAC name is [2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-phenylethyl] 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate.
| Compound Name | [2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-phenylethyl] 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 70530823 |
| Molecular Formula | C38H40BrCl2N3O4 |
| Molecular Weight | 753.57 g/mol |
| Exact Mass | 751.16 |
| IUPAC Name | [2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-phenylethyl] 4-amino-3-bromo-5-[[(1-ethylcyclohexyl)amino]methyl]benzoate |
| SMILES | CCC1(NCc2cc(C(=O)OCC(OC(=O)Cc3ccccc3Nc3c(Cl)cccc3Cl)c3ccccc3)cc(Br)c2N)CCCCC1 |
| InChI | InChI=1S/C38H40BrCl2N3O4/c1-2-38(18-9-4-10-19-38)43-23-28-20-27(21-29(39)35(28)42)37(46)47-24-33(25-12-5-3-6-13-25)48-34(45)22-26-14-7-8-17-32(26)44-36-30(40)15-11-16-31(36)41/h3,5-8,11-17,20-21,33,43-44H,2,4,9-10,18-19,22-24,42H2,1H3 |
| InChIKey | PZLVVXJEZHCSGR-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.57 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|