C35H43BrCl3N3O4 — CID 70579732
5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate;hydrochloride (PubChem CID 70579732) has the molecular formula C35H43BrCl3N3O4 and a molecular weight of 756.01 g/mol. Its IUPAC name is 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate;hydrochloride.
| Compound Name | 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 70579732 |
| Molecular Formula | C35H43BrCl3N3O4 |
| Molecular Weight | 756.01 g/mol |
| Exact Mass | 753.15 |
| IUPAC Name | 5-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxypentyl 4-amino-3-bromo-5-[cyclohexyl(ethylamino)methyl]benzoate;hydrochloride |
| SMILES | CCNC(c1cc(C(=O)OCCCCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)cc(Br)c1N)C1CCCCC1.Cl |
| InChI | InChI=1S/C35H42BrCl2N3O4.ClH/c1-2-40-33(23-12-5-3-6-13-23)26-20-25(21-27(36)32(26)39)35(43)45-19-10-4-9-18-44-31(42)22-24-14-7-8-17-30(24)41-34-28(37)15-11-16-29(34)38;/h7-8,11,14-17,20-21,23,33,40-41H,2-6,9-10,12-13,18-19,22,39H2,1H3;1H |
| InChIKey | XMFJILKQROTSHD-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.01 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|