C33H40BrCl2N3O4 — CID 70548344
5-acetyloxypentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 70548344) has the molecular formula C33H40BrCl2N3O4 and a molecular weight of 693.51 g/mol. Its IUPAC name is 5-acetyloxypentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 5-acetyloxypentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 70548344 |
| Molecular Formula | C33H40BrCl2N3O4 |
| Molecular Weight | 693.51 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | 5-acetyloxypentyl 4-amino-3-bromo-5-[(cyclohexylamino)methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CC(=O)OCCCCCOC(=O)c1cc(Br)c(N)c(CNC2CCCCC2)c1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C21H31BrN2O4.C12H9Cl2N/c1-15(25)27-10-6-3-7-11-28-21(26)16-12-17(20(23)19(22)13-16)14-24-18-8-4-2-5-9-18;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h12-13,18,24H,2-11,14,23H2,1H3;1-8,15H |
| InChIKey | JEDYFAQDEGUYHT-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.51 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|