C35H44BrCl2N3O4 — CID 70548216
4-acetyloxybutyl 4-amino-3-bromo-5-[[cyclohexyl(propyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline (PubChem CID 70548216) has the molecular formula C35H44BrCl2N3O4 and a molecular weight of 721.56 g/mol. Its IUPAC name is 4-acetyloxybutyl 4-amino-3-bromo-5-[[cyclohexyl(propyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline.
| Compound Name | 4-acetyloxybutyl 4-amino-3-bromo-5-[[cyclohexyl(propyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
|---|---|
| PubChem CID | 70548216 |
| Molecular Formula | C35H44BrCl2N3O4 |
| Molecular Weight | 721.56 g/mol |
| Exact Mass | 719.19 |
| IUPAC Name | 4-acetyloxybutyl 4-amino-3-bromo-5-[[cyclohexyl(propyl)amino]methyl]benzoate;2,6-dichloro-N-phenylaniline |
| SMILES | CCCN(Cc1cc(C(=O)OCCCCOC(C)=O)cc(Br)c1N)C1CCCCC1.Clc1cccc(Cl)c1Nc1ccccc1 |
| InChI | InChI=1S/C23H35BrN2O4.C12H9Cl2N/c1-3-11-26(20-9-5-4-6-10-20)16-19-14-18(15-21(24)22(19)25)23(28)30-13-8-7-12-29-17(2)27;13-10-7-4-8-11(14)12(10)15-9-5-2-1-3-6-9/h14-15,20H,3-13,16,25H2,1-2H3;1-8,15H |
| InChIKey | DIYIUMAPFJJJBB-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.56 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|