C39H51BrN3O5+ — CID 173433533
2-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]oxyethyl-[2-[2-(3-benzoylphenyl)propanoyloxy]ethyl]-propylazanium (PubChem CID 173433533) has the molecular formula C39H51BrN3O5+ and a molecular weight of 721.76 g/mol. Its IUPAC name is 2-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]oxyethyl-[2-[2-(3-benzoylphenyl)propanoyloxy]ethyl]-propylazanium.
| Compound Name | 2-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]oxyethyl-[2-[2-(3-benzoylphenyl)propanoyloxy]ethyl]-propylazanium |
|---|---|
| PubChem CID | 173433533 |
| Molecular Formula | C39H51BrN3O5+ |
| Molecular Weight | 721.76 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | 2-[4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoyl]oxyethyl-[2-[2-(3-benzoylphenyl)propanoyloxy]ethyl]-propylazanium |
| SMILES | CCC[NH+](CCOC(=O)c1cc(Br)c(N)c(CN(CC)C2CCCCC2)c1)CCOC(=O)C(C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C39H50BrN3O5/c1-4-19-42(20-22-47-38(45)28(3)30-15-12-16-31(24-30)37(44)29-13-8-6-9-14-29)21-23-48-39(46)32-25-33(36(41)35(40)26-32)27-43(5-2)34-17-10-7-11-18-34/h6,8-9,12-16,24-26,28,34H,4-5,7,10-11,17-23,27,41H2,1-3H3/p+1 |
| InChIKey | OLEMXHVDUOFJJY-UHFFFAOYSA-O |
| XLogP | 6.22 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|