C32H37BrN2O5 — CID 20516037
4-[2-(3-benzoylphenyl)propanoyloxy]butyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate (PubChem CID 20516037) has the molecular formula C32H37BrN2O5 and a molecular weight of 609.56 g/mol. Its IUPAC name is 4-[2-(3-benzoylphenyl)propanoyloxy]butyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate.
| Compound Name | 4-[2-(3-benzoylphenyl)propanoyloxy]butyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 20516037 |
| Molecular Formula | C32H37BrN2O5 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 4-[2-(3-benzoylphenyl)propanoyloxy]butyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCCCOC(=O)C(C)c2cccc(C(=O)c3ccccc3)c2)cc(Br)c1N |
| InChI | InChI=1S/C32H37BrN2O5/c1-4-35(5-2)21-27-19-26(20-28(33)29(27)34)32(38)40-17-10-9-16-39-31(37)22(3)24-14-11-15-25(18-24)30(36)23-12-7-6-8-13-23/h6-8,11-15,18-20,22H,4-5,9-10,16-17,21,34H2,1-3H3 |
| InChIKey | AFKHAXJDKYIVKM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|