C33H40BrFN2O4 — CID 20516065
6-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyhexyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate (PubChem CID 20516065) has the molecular formula C33H40BrFN2O4 and a molecular weight of 627.60 g/mol. Its IUPAC name is 6-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyhexyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate.
| Compound Name | 6-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyhexyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 20516065 |
| Molecular Formula | C33H40BrFN2O4 |
| Molecular Weight | 627.60 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | 6-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyhexyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCCCCCOC(=O)C(C)(F)c2ccc(-c3ccccc3)cc2)cc(Br)c1N |
| InChI | InChI=1S/C33H40BrFN2O4/c1-4-37(5-2)23-27-21-26(22-29(34)30(27)36)31(38)40-19-11-6-7-12-20-41-32(39)33(3,35)28-17-15-25(16-18-28)24-13-9-8-10-14-24/h8-10,13-18,21-22H,4-7,11-12,19-20,23,36H2,1-3H3 |
| InChIKey | XSQOABLYARJQCF-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.60 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|