About 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate
2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate (PubChem CID 20516395) has the molecular formula C16H23ClN2O4
and a molecular weight of 342.82 g/mol. Its IUPAC name is 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate.
Molecular Properties
| Compound Name | 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate |
| PubChem CID | 20516395 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCOC(C)=O)cc(Cl)c1N |
| InChI | InChI=1S/C16H23ClN2O4/c1-4-19(5-2)10-13-8-12(9-14(17)15(13)18)16(21)23-7-6-22-11(3)20/h8-9H,4-7,10,18H2,1-3H3 |
| InChIKey | VORZHWBDHJIDBO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate?
The IUPAC name of 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate (CID 20516395) is 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate.
What is the SMILES notation for 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate?
The canonical SMILES for 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate is CCN(CC)Cc1cc(C(=O)OCCOC(C)=O)cc(Cl)c1N.
What is the InChIKey of 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate?
The InChIKey is VORZHWBDHJIDBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2O4/c1-4-19(5-2)10-13-8-12(9-14(17)15(13)18)16(21)23-7-6-22-11(3)20/h8-9H,4-7,10,18H2,1-3H3.
What are the key properties of 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate?
2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate has a molecular weight of 342.82 g/mol, XLogP of 2.48, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl 4-amino-3-chloro-5-(diethylaminomethyl)benzoate is sourced from PubChem (CID 20516395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).