C17H26BrClN2O2 — CID 54226134
5-chloropentyl 4-amino-3-bromo-5-[[methyl(propyl)amino]methyl]benzoate (PubChem CID 54226134) has the molecular formula C17H26BrClN2O2 and a molecular weight of 405.76 g/mol. Its IUPAC name is 5-chloropentyl 4-amino-3-bromo-5-[[methyl(propyl)amino]methyl]benzoate.
| Compound Name | 5-chloropentyl 4-amino-3-bromo-5-[[methyl(propyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 54226134 |
| Molecular Formula | C17H26BrClN2O2 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 5-chloropentyl 4-amino-3-bromo-5-[[methyl(propyl)amino]methyl]benzoate |
| SMILES | CCCN(C)Cc1cc(C(=O)OCCCCCCl)cc(Br)c1N |
| InChI | InChI=1S/C17H26BrClN2O2/c1-3-8-21(2)12-14-10-13(11-15(18)16(14)20)17(22)23-9-6-4-5-7-19/h10-11H,3-9,12,20H2,1-2H3 |
| InChIKey | QFZHRCJDNOECHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|