C30H33BrN2O5 — CID 20516417
2-[2-(3-benzoylphenyl)propanoyloxy]ethyl 4-amino-3-bromo-5-[(tert-butylamino)methyl]benzoate (PubChem CID 20516417) has the molecular formula C30H33BrN2O5 and a molecular weight of 581.51 g/mol. Its IUPAC name is 2-[2-(3-benzoylphenyl)propanoyloxy]ethyl 4-amino-3-bromo-5-[(tert-butylamino)methyl]benzoate.
| Compound Name | 2-[2-(3-benzoylphenyl)propanoyloxy]ethyl 4-amino-3-bromo-5-[(tert-butylamino)methyl]benzoate |
|---|---|
| PubChem CID | 20516417 |
| Molecular Formula | C30H33BrN2O5 |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[2-(3-benzoylphenyl)propanoyloxy]ethyl 4-amino-3-bromo-5-[(tert-butylamino)methyl]benzoate |
| SMILES | CC(C(=O)OCCOC(=O)c1cc(Br)c(N)c(CNC(C)(C)C)c1)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H33BrN2O5/c1-19(21-11-8-12-22(15-21)27(34)20-9-6-5-7-10-20)28(35)37-13-14-38-29(36)23-16-24(18-33-30(2,3)4)26(32)25(31)17-23/h5-12,15-17,19,33H,13-14,18,32H2,1-4H3 |
| InChIKey | GDQOGGJEYLGQPY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|