C35H41BrN2O6 — CID 20516122
[3-[2-(3-benzoylphenyl)propanoyloxy]-2-hydroxypropyl] 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate (PubChem CID 20516122) has the molecular formula C35H41BrN2O6 and a molecular weight of 665.63 g/mol. Its IUPAC name is [3-[2-(3-benzoylphenyl)propanoyloxy]-2-hydroxypropyl] 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate.
| Compound Name | [3-[2-(3-benzoylphenyl)propanoyloxy]-2-hydroxypropyl] 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 20516122 |
| Molecular Formula | C35H41BrN2O6 |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | [3-[2-(3-benzoylphenyl)propanoyloxy]-2-hydroxypropyl] 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
| SMILES | CCN(Cc1cc(C(=O)OCC(O)COC(=O)C(C)c2cccc(C(=O)c3ccccc3)c2)cc(Br)c1N)C1CCCCC1 |
| InChI | InChI=1S/C35H41BrN2O6/c1-3-38(29-15-8-5-9-16-29)20-28-18-27(19-31(36)32(28)37)35(42)44-22-30(39)21-43-34(41)23(2)25-13-10-14-26(17-25)33(40)24-11-6-4-7-12-24/h4,6-7,10-14,17-19,23,29-30,39H,3,5,8-9,15-16,20-22,37H2,1-2H3 |
| InChIKey | YLLBDKCEOBJTJF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|