C16H22BrN2NaO2 — CID 23695093
sodium 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate (PubChem CID 23695093) has the molecular formula C16H22BrN2NaO2 and a molecular weight of 377.26 g/mol. Its IUPAC name is sodium 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate.
| Compound Name | sodium 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 23695093 |
| Molecular Formula | C16H22BrN2NaO2 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | sodium 4-amino-3-bromo-5-[[cyclohexyl(ethyl)amino]methyl]benzoate |
| SMILES | CCN(Cc1cc(C(=O)[O-])cc(Br)c1N)C1CCCCC1.[Na+] |
| InChI | InChI=1S/C16H23BrN2O2.Na/c1-2-19(13-6-4-3-5-7-13)10-12-8-11(16(20)21)9-14(17)15(12)18;/h8-9,13H,2-7,10,18H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | AVKIDCLTDUJXRP-UHFFFAOYSA-M |
| XLogP | -0.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|